Common Name: Kaempferol-3-O-glucosyl(1-2)rhamnoside
Synonyms: Kaempferol-3-O-glucosyl(1-2)rhamnoside
CAS Registry Number:
InChI: InChI=1S/C27H30O15/c1-9-17(32)21(36)25(42-26-22(37)20(35)18(33)15(8-28)40-26)27(38-9)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20-,21+,22+,25+,26-,27-/m0/s1
InChIKey: InChIKey=BCNBWICEIXAVQF-DLVIKRKZSA-N
Formula: C27H30O15
Molecular Weight: 594.519166
Exact Mass: 594.15847
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Norbaek, R., Kondo, T. Phytochemistry (1999) 51, 1113-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.5 |
| 3 (C) | 135 |
| 4 (C) | 178.1 |
| 5 (C) | 161.5 |
| 6 (CH) | 99 |
| 7 (C) | 164.5 |
| 8 (CH) | 94.1 |
| 9 (C) | 157 |
| 10 (C) | 104.6 |
| 1' (C) | 120.9 |
| 2' (CH) | 131 |
| 3' (CH) | 116.2 |
| 4' (C) | 160.4 |
| 5' (CH) | 116.2 |
| 6' (CH) | 131 |
| 1'' (CH) | 101.3 |
| 2'' (CH) | 81.7 |
| 3'' (CH) | 70.5 |
| 4'' (CH) | 72 |
| 5'' (CH) | 70.8 |
| 6'' (CH3) | 17.6 |
| 1''' (CH) | 106.5 |
| 2''' (CH) | 69.6 |
| 3''' (CH) | 76.5 |
| 4''' (CH) | 74.1 |
| 5''' (CH) | 76.9 |
| 6''' (CH2) | 60.8 |