Common Name: Baimaside
Synonyms: Baimaside
CAS Registry Number:
InChI: InChI=1S/C27H30O17/c28-6-14-17(34)20(37)22(39)26(41-14)44-25-21(38)18(35)15(7-29)42-27(25)43-24-19(36)16-12(33)4-9(30)5-13(16)40-23(24)8-1-2-10(31)11(32)3-8/h1-5,14-15,17-18,20-22,25-35,37-39H,6-7H2/t14-,15-,17-,18-,20+,21+,22-,25-,26+,27+/m1/s1
InChIKey: InChIKey=RDUAJIJVNHKTQC-UJECXLDQSA-N
Formula: C27H30O17
Molecular Weight: 626.517976
Exact Mass: 626.1483
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Norbaek, R., Kondo, T. Phytochemistry (1999) 51, 1113-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 156.7 |
| 3 (C) | 133.5 |
| 4 (C) | 177.9 |
| 5 (C) | 161.6 |
| 6 (CH) | 98.5 |
| 7 (C) | 164.4 |
| 8 (CH) | 93.8 |
| 9 (C) | 156 |
| 10 (C) | 104.5 |
| 1' (C) | 122.2 |
| 2' (CH) | 116.5 |
| 3' (C) | 145.1 |
| 4' (C) | 148.8 |
| 5' (CH) | 115.8 |
| 6' (CH) | 121.6 |
| 1'' (CH) | 99 |
| 2'' (CH) | 83.1 |
| 3'' (CH) | 76.9 |
| 4'' (CH) | 69.9 |
| 5'' (CH) | 77.8 |
| 6'' (CH2) | 61 |
| 1''' (CH) | 104.4 |
| 2''' (CH) | 74.6 |
| 3''' (CH) | 76.8 |
| 4''' (CH) | 69.8 |
| 5''' (CH) | 77.1 |
| 6''' (CH2) | 60.9 |