Common Name: 3-[(2-O-alpha-L-Rhamnopyranosyl-alpha-L-rhamnopyranosyl)oxy]-3',4',5,5',7-pentahydroxyflavone
Synonyms: 3-[(2-O-alpha-L-Rhamnopyranosyl-alpha-L-rhamnopyranosyl)oxy]-3',4',5,5',7-pentahydroxyflavone
CAS Registry Number:
InChI: InChI=1S/C27H30O16/c1-7-16(32)20(36)22(38)26(39-7)43-25-21(37)17(33)8(2)40-27(25)42-24-19(35)15-11(29)5-10(28)6-14(15)41-23(24)9-3-12(30)18(34)13(31)4-9/h3-8,16-17,20-22,25-34,36-38H,1-2H3/t7-,8-,16-,17-,20+,21+,22+,25+,26-,27-/m0/s1
InChIKey: InChIKey=UMLQYKKIQCBBDM-XYSSDXFWSA-N
Formula: C27H30O16
Molecular Weight: 610.518571
Exact Mass: 610.153385
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Braca, A., Bilia, A.R., Mendez, J., Morelli, I. Phytochemistry (1999) 51, 1125-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 157.4 |
| 3 (C) | 136 |
| 4 (C) | 178.2 |
| 5 (C) | 163.9 |
| 6 (CH) | 99.8 |
| 7 (C) | 165.9 |
| 8 (CH) | 94.7 |
| 9 (C) | 158.5 |
| 10 (C) | 104.5 |
| 1' (C) | 121.8 |
| 2' (CH) | 109.5 |
| 3' (C) | 146.9 |
| 4' (C) | 137.3 |
| 5' (C) | 146.9 |
| 6' (CH) | 109.5 |
| 1'' (CH) | 103.8 |
| 2'' (CH) | 79.1 |
| 3'' (CH) | 71.8 |
| 4'' (CH) | 72 |
| 5'' (CH) | 70.3 |
| 6'' (CH3) | 17.8 |
| 1''' (CH) | 102.4 |
| 2''' (CH) | 72.2 |
| 3''' (CH) | 73.6 |
| 4''' (CH) | 73.9 |
| 5''' (CH) | 70.8 |
| 6''' (CH3) | 17.8 |