Common Name: Quercetin-3-rhamnoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3/t7-,15-,17+,18+,21-/m0/s1
InChIKey: InChIKey=OXGUCUVFOIWWQJ-HQBVPOQASA-N
Formula: C21H20O11
Molecular Weight: 448.377723
Exact Mass: 448.100561
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fossen, T., Larsen, A., Kiremirec, B.T., Andersen, O.M. Phytochemistry (1999) 51, 1133-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.56 |
| 3 (C) | 136.28 |
| 4 (C) | 179.69 |
| 5 (C) | 163.25 |
| 6 (CH) | 99.84 |
| 7 (C) | 165.89 |
| 8 (CH) | 94.74 |
| 9 (C) | 159.35 |
| 10 (C) | 105.94 |
| 1' (C) | 123.01 |
| 2' (CH) | 116.97 |
| 3' (C) | 149.83 |
| 4' (C) | 146.45 |
| 5' (CH) | 116.4 |
| 6' (CH) | 122.9 |
| 1'' (CH) | 103.58 |
| 2'' (CH) | 71.94 |
| 3'' (CH) | 72.15 |
| 4'' (CH) | 73.3 |
| 5'' (CH) | 72.07 |
| 6'' (CH3) | 17.69 |