Common Name: Kaempferol 3-rhamnoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H20O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-18,21-25,27-28H,1H3/t8-,15-,17+,18+,21-/m0/s1
InChIKey: InChIKey=SOSLMHZOJATCCP-AEIZVZFYSA-N
Formula: C21H20O10
Molecular Weight: 432.378318
Exact Mass: 432.105647
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fossen, T., Larsen, A., Kiremirec, B.T., Andersen, O.M. Phytochemistry (1999) 51, 1133-7
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 159.32 |
| 3 (C) | 136.23 |
| 4 (C) | 179.66 |
| 5 (C) | 163.26 |
| 6 (CH) | 99.84 |
| 7 (C) | 165.93 |
| 8 (CH) | 94.75 |
| 9 (C) | 158.59 |
| 10 (C) | 105.94 |
| 1' (C) | 122.64 |
| 2' (CH) | 131.91 |
| 3' (CH) | 116.54 |
| 4' (C) | 161.62 |
| 5' (CH) | 116.54 |
| 6' (CH) | 131.91 |
| 1'' (CH) | 103.52 |
| 2'' (CH) | 71.93 |
| 3'' (CH) | 72.13 |
| 4'' (CH) | 73.19 |
| 5'' (CH) | 72.05 |
| 6'' (CH3) | 17.66 |