Common Name: Dihydrokaempferol 7-O-β-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H22O11/c22-7-13-15(25)17(27)19(29)21(32-13)30-10-5-11(24)14-12(6-10)31-20(18(28)16(14)26)8-1-3-9(23)4-2-8/h1-6,13,15,17-25,27-29H,7H2/t13-,15-,17+,18+,19-,20-,21-/m1/s1
InChIKey: InChIKey=UDIXYHJHYVDNOG-JUIPTLLLSA-N
Formula: C21H22O11
Molecular Weight: 450.393605
Exact Mass: 450.116212
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Norbaek, R., Nielsen, J.K., Kondo, T. Phytochemistry (1999) 51, 1139-46
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 83.4 |
| 3 (CH) | 71.9 |
| 4 (C) | 198.9 |
| 5 (C) | 162.8 |
| 6 (CH) | 97.1 |
| 7 (C) | 165.7 |
| 8 (CH) | 95.7 |
| 9 (C) | 158.6 |
| 10 (C) | 102.4 |
| 1' (C) | 127.7 |
| 2' (CH) | 129.8 |
| 3' (CH) | 115.2 |
| 4' (C) | 158.6 |
| 5' (CH) | 115.2 |
| 6' (CH) | 129.8 |
| 1'' (CH) | 100 |
| 2'' (CH) | 73.2 |
| 3'' (CH) | 76.5 |
| 4'' (CH) | 69.8 |
| 5'' (CH) | 77.4 |
| 6'' (CH2) | 60.8 |