Common Name: 6,7-Dimethoxyisoflavone
Synonyms: 6,7-Dimethoxyisoflavone
CAS Registry Number:
InChI: InChI=1S/C17H14O4/c1-19-15-8-12-14(9-16(15)20-2)21-10-13(17(12)18)11-6-4-3-5-7-11/h3-10H,1-2H3
InChIKey: InChIKey=CSZUZQUAXVPYIL-UHFFFAOYSA-N
Formula: C17H14O4
Molecular Weight: 282.291301
Exact Mass: 282.089209
NMR Solvent: CDDl3 + DMSO-d6
MHz:
Calibration:
NMR references: 13C - Jha, B.C., Zilliken, F., Breitmaier, B. Can J Chem (1980) 58, 1211
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 153.2 |
| 3 (C) | 123.6 |
| 4 (C) | 174.3 |
| 5 (CH) | 104.4 |
| 6 (C) | 147.6 |
| 7 (C) | 154.4 |
| 8 (CH) | 100.1 |
| 9 (C) | 152 |
| 10 (C) | 117.3 |
| 1' (C) | 132.3 |
| 2' (CH) | 128.9 |
| 3' (CH) | 128.1 |
| 4' (CH) | 127.7 |
| 5' (CH) | 128.1 |
| 6' (CH) | 128.9 |
| 6a (CH3) | 55.8 |
| 7a (CH3) | 56.3 |