Common Name: Lonchocarpuson
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H22O6/c1-23(2)9-8-13-17(29-23)7-6-14-21(24)16(12-28-22(13)14)15-10-19(26-4)20(27-5)11-18(15)25-3/h6-12H,1-5H3
InChIKey: InChIKey=OBIUGMGQVQMVSK-UHFFFAOYSA-N
Formula: C23H22O6
Molecular Weight: 394.418052
Exact Mass: 394.141638
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Kaouadji, M., Agban, A., Mariotte, A.M. J Nat Prod (1986) 49, 281-5
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 154 |
| 3 (C) | 121.6 |
| 4 (C) | 175.8 |
| 5 (CH) | 126.8 |
| 6 (CH) | 115.7 |
| 7 (C) | 157.2 |
| 8 (C) | 109.3 |
| 9 (C) | 152.4 |
| 10 (C) | 118.5 |
| 1' (C) | 112.5 |
| 2' (C) | 152 |
| 3' (CH) | 98.7 |
| 4' (C) | 149.9 |
| 5' (C) | 143.3 |
| 6' (CH) | 115.1 |
| 8a (CH) | 115.7 |
| 8b (CH) | 130.2 |
| 8c (C) | 77.6 |
| 8d (CH3) | 28.1 |
| 8e (CH3) | 28.1 |
| 2'a (CH3) | 56.3 |
| 4'a (CH3) | 56.7 |
| 5'a (CH3) | 57 |