Common Name: 7-(4-Methoxyphenyl)-2,2-dimethyl-2H,6H-pyrano[3,2-g]chromen-6-one
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H18O4/c1-21(2)9-8-14-10-16-19(11-18(14)25-21)24-12-17(20(16)22)13-4-6-15(23-3)7-5-13/h4-12H,1-3H3
InChIKey: InChIKey=YJDRRALEPJSKSX-UHFFFAOYSA-N
Formula: C21H18O4
Molecular Weight: 334.366007
Exact Mass: 334.120509
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Vilain, C., Jadot, J. Bull Soc Chim Belg (1977) 86, 473
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 151.7 |
| 3 (C) | 124.2 |
| 4 (C) | 175.3 |
| 5 (CH) | 123.4 |
| 6 (C) | 119.6 |
| 7 (C) | 157.8 |
| 8 (CH) | 103.7 |
| 9 (C) | 157.2 |
| 10 (C) | 118.4 |
| 1' (C) | 124.2 |
| 2' (CH) | 130 |
| 3' (CH) | 113.8 |
| 4' (C) | 159.3 |
| 5' (CH) | 113.8 |
| 6' (CH) | 130 |
| 6a (CH) | 121.3 |
| 6b (CH) | 131.5 |
| 6c (C) | 77.7 |
| 6d (CH3) | 28.3 |
| 6e (CH3) | 28.3 |
| 4'a (CH3) | 55.2 |