Common Name: 8-Hydroxy-6,11-dimethoxy-3a,12c-dihydro-7H-furo[3',2':4,5]furo[2,3-c]xanthen-7-one
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C19H14O7/c1-22-10-4-3-9(20)14-16(21)15-11(23-2)7-12-13(18(15)26-17(10)14)8-5-6-24-19(8)25-12/h3-8,19-20H,1-2H3
InChIKey: InChIKey=VVRUNWFPOWIBDY-UHFFFAOYSA-N
Formula: C19H14O7
Molecular Weight: 354.310987
Exact Mass: 354.073953
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Shao, C., She, Z., Guo, Z., Peng, H., Cai, X., Zhou, S., Gu, Y., Lin, Y. Magn Reson Chem (2007) 45, 434-8
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 163.29 |
| 2 (CH) | 90.61 |
| 3 (C) | 164.57 |
| 4 (C) | 106.77 |
| 4a (C) | 144.71 |
| 5 (C) | 139.39 |
| 6 (CH) | 120.42 |
| 7 (CH) | 109.5 |
| 8 (C) | 155.27 |
| 8a (C) | 109.5 |
| 9 (C) | 181.28 |
| 9a (C) | 106.06 |
| 10a (C) | 153.97 |
| 1' (CH3) | 56.79 |
| 1'' (CH) | 48.13 |
| 2'' (CH) | 113.3 |
| 3'' (CH) | 102.57 |
| 4'' (CH) | 145.25 |
| 1''' (CH3) | 57.71 |