Common Name: Quercetin 3-O-β-D-glupopyranoside(1-->4)-β-D-galactopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H30O17/c28-6-14-17(34)19(36)21(38)26(41-14)43-24-15(7-29)42-27(22(39)20(24)37)44-25-18(35)16-12(33)4-9(30)5-13(16)40-23(25)8-1-2-10(31)11(32)3-8/h1-5,14-15,17,19-22,24,26-34,36-39H,6-7H2/t14-,15-,17-,19+,20-,21-,22-,24+,26+,27+/m1/s1
InChIKey: InChIKey=UTECWQIXBMWRRR-IOISQHTLSA-N
Formula: C27H30O17
Molecular Weight: 626.517976
Exact Mass: 626.1483
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Hasan, A., Ahmed, I., Jay, M., Voirin, B. Phytochemistry (1995) 39, 1211-3
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.2 |
| 3 (C) | 135.8 |
| 4 (C) | 178.9 |
| 5 (C) | 162.7 |
| 6 (CH) | 101.3 |
| 7 (C) | 166.3 |
| 8 (CH) | 95.7 |
| 9 (C) | 158.9 |
| 10 (C) | 104.5 |
| 1' (C) | 123.1 |
| 2' (CH) | 116.6 |
| 3' (C) | 145.8 |
| 4' (C) | 150 |
| 5' (CH) | 116.7 |
| 6' (CH) | 122.9 |
| 1'' (CH) | 101.3 |
| 2'' (CH) | 71.2 |
| 3'' (CH) | 73.2 |
| 4'' (CH) | 78.3 |
| 5'' (CH) | 75.1 |
| 6'' (CH2) | 61.9 |
| 1''' (CH) | 104.8 |
| 2''' (CH) | 75.2 |
| 3''' (CH) | 77.1 |
| 4''' (CH) | 70 |
| 5''' (CH) | 78.1 |
| 6''' (CH2) | 62.5 |