Common Name: 3,4-Dimethoxyphenyl 6-O-(a-L-Rhamnopyranosyl)-b-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H30O12/c1-8-13(21)15(23)17(25)19(30-8)29-7-12-14(22)16(24)18(26)20(32-12)31-9-4-5-10(27-2)11(6-9)28-3/h4-6,8,12-26H,7H2,1-3H3/t8-,12+,13-,14+,15+,16-,17-,18+,19-,20+/m1/s1
InChIKey: InChIKey=ALPIUWBZQOROIJ-NYMJEGPGSA-N
Formula: C20H30O12
Molecular Weight: 462.4458
Exact Mass: 462.173726
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Graikou, K., Aligiannis, N., Chinou, L., Skaltsounis, A.L., Tillequin, F.O., Litaudon, M. Helv Chim Acta (2005) 88, 2654-60
Species:
Notes: Family : Aromatics, Type : Benzenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 153.8 |
| 2 (CH) | 104.2 |
| 3 (C) | 151 |
| 4 (C) | 146.1 |
| 5 (CH) | 113.9 |
| 6 (CH) | 109.3 |
| 1' (CH) | 103.4 |
| 2' (CH) | 74.9 |
| 3' (CH) | 78 |
| 4' (CH) | 71.5 |
| 5' (CH) | 76.9 |
| 6' (CH2) | 68 |
| 1'' (CH) | 102.2 |
| 2'' (CH) | 72.2 |
| 3'' (CH) | 69.8 |
| 4'' (CH) | 74 |
| 5'' (CH) | 72.4 |
| 6'' (CH3) | 17.9 |
| 3a (CH3) | 57.1 |
| 4a (CH3) | 56.5 |