Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H36O11/c1-26(15-9-19(38-24(15)33)27(2)14(23(32)34-3)5-4-6-18(26)27)10-16(13-7-8-35-12-13)36-25-22(31)21(30)20(29)17(11-28)37-25/h5,7-8,12,15-22,25,28-31H,4,6,9-11H2,1-3H3/t15-,16?,17+,18-,19-,20+,21-,22+,25+,26-,27-/m1/s1
InChIKey: InChIKey=ZXGKLWUOGQDOTD-WPQKENIJSA-N
Formula: C27H36O11
Molecular Weight: 536.569191
Exact Mass: 536.225762
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Martin, T.S., Ohtani, K., Kasai, R., Yamasaki, K. Phytochemistry (1996) 42, 153-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 16.5 |
| 2 (CH2) | 24.2 |
| 3 (CH) | 142.6 |
| 4 (C) | 134.4 |
| 5 (C) | 39.4 |
| 6 (CH) | 82.8 |
| 7 (CH2) | 29.5 |
| 8 (CH) | 46.8 |
| 9 (C) | 39.7 |
| 10 (CH) | 45.8 |
| 11 (CH2) | 47.6 |
| 12 (CH) | 69.3 |
| 13 (C) | 128.4 |
| 14 (CH) | 110.3 |
| 15 (CH) | 143.6 |
| 16 (CH) | 140.7 |
| 17 (C) | 178.3 |
| 18 (C) | 166.8 |
| 19 (CH3) | 27.1 |
| 20 (CH3) | 21.5 |
| 1' (CH) | 101.4 |
| 2' (CH) | 75.4 |
| 3' (CH) | 78.5 |
| 4' (CH) | 72.1 |
| 5' (CH) | 78.1 |
| 6' (CH2) | 63 |
| 18a (CH3) | 51.5 |