Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C33H46O16/c1-32(16-9-21(49-29(16)42)33(2)15(28(41)43-3)5-4-6-20(32)33)10-17(14-7-8-44-12-14)46-31-27(40)25(38)23(36)19(48-31)13-45-30-26(39)24(37)22(35)18(11-34)47-30/h5,7-8,12,16-27,30-31,34-40H,4,6,9-11,13H2,1-3H3/t16-,17?,18-,19+,20-,21-,22-,23+,24+,25-,26-,27+,30-,31+,32-,33-/m1/s1
InChIKey: InChIKey=RDANOZJKKFLLEO-SHVLKNRUSA-N
Formula: C33H46O16
Molecular Weight: 698.710038
Exact Mass: 698.278585
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Martin, T.S., Ohtani, K., Kasai, R., Yamasaki, K. Phytochemistry (1996) 42, 153-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 16.6 |
| 2 (CH2) | 24.3 |
| 3 (CH) | 142.5 |
| 4 (C) | 134.7 |
| 5 (C) | 39.6 |
| 6 (CH) | 82.8 |
| 7 (CH2) | 29.6 |
| 8 (CH) | 47.1 |
| 9 (C) | 39.9 |
| 10 (CH) | 45.8 |
| 11 (CH2) | 47.5 |
| 12 (CH) | 69.2 |
| 13 (C) | 128.4 |
| 14 (CH) | 110.4 |
| 15 (CH) | 143.4 |
| 16 (CH) | 140.9 |
| 17 (C) | 178.3 |
| 18 (C) | 166.9 |
| 19 (CH3) | 27.3 |
| 20 (CH3) | 21.4 |
| 1' (CH) | 101.2 |
| 2' (CH) | 75.2 |
| 3' (CH) | 78.3 |
| 4' (CH) | 71.7 |
| 5' (CH) | 76.9 |
| 6' (CH2) | 70.9 |
| 1'' (CH) | 105.4 |
| 2'' (CH) | 75.4 |
| 3'' (CH) | 78.4 |
| 4'' (CH) | 72.2 |
| 5'' (CH) | 78.4 |
| 6'' (CH2) | 62.8 |
| 18a (CH3) | 51.5 |