Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C33H46O16/c1-32(16-9-21(49-29(16)42)33(2)15(28(41)43-3)5-4-6-20(32)33)10-17(14-7-8-44-12-14)46-31-27(40)25(38)23(36)19(48-31)13-45-30-26(39)24(37)22(35)18(11-34)47-30/h5,7-8,12,16-27,30-31,34-40H,4,6,9-11,13H2,1-3H3/t16-,17?,18-,19+,20-,21-,22-,23+,24+,25-,26-,27+,30-,31+,32-,33-/m1/s1
InChIKey: InChIKey=RDANOZJKKFLLEO-SHVLKNRUSA-N
Formula: C33H46O16
Molecular Weight: 698.710038
Exact Mass: 698.278585
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Martin, T.S., Ohtani, K., Kasai, R., Yamasaki, K. Phytochemistry (1996) 42, 153-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 16 |
| 2 (CH2) | 23.8 |
| 3 (CH) | 142.6 |
| 4 (C) | 133.5 |
| 5 (C) | 38.6 |
| 6 (CH) | 82 |
| 7 (CH2) | 28.5 |
| 8 (CH) | 46 |
| 9 (C) | 38.8 |
| 10 (CH) | 44.9 |
| 11 (CH2) | 64 |
| 12 (CH) | 67.8 |
| 13 (C) | 127.1 |
| 14 (CH) | 109.5 |
| 15 (CH) | 143.2 |
| 16 (CH) | 140.1 |
| 17 (C) | 177.4 |
| 18 (C) | 166.4 |
| 19 (CH3) | 26.9 |
| 20 (CH3) | 20.5 |
| 1' (CH) | 99.6 |
| 2' (CH) | 73.6 |
| 3' (CH) | 76.7 |
| 4' (CH) | 70.1 |
| 5' (CH) | 75.7 |
| 6' (CH2) | 69.1 |
| 1'' (CH) | 103.5 |
| 2'' (CH) | 73.6 |
| 3'' (CH) | 76.9 |
| 4'' (CH) | 70.7 |
| 5'' (CH) | 76.8 |
| 6'' (CH2) | 61.2 |
| 18a (CH3) | 51.7 |