Common Name: ent-8-9-seco-7α-hydroxykaur-17-thiophenylkaur-8(14)-en-9,15-dione
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H34O3S/c1-25(2)12-7-13-26(3)22(25)15-21(27)19-14-17(10-11-23(26)28)20(24(19)29)16-30-18-8-5-4-6-9-18/h4-6,8-9,14,17,20-22,27H,7,10-13,15-16H2,1-3H3/t17-,20+,21+,22+,26+/m0/s1
InChIKey: InChIKey=ZGAZLDOAFMUNOH-IHXIMJEQSA-N
Formula: C26H34O3S1
Molecular Weight: 426.613418
Exact Mass: 426.222866
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Perry, N.B., Burgess, E.J., Baek, S.H., Weavers, R.T., Geis, W., Mauer, A.B. Phytochemistry (1999) 50, 423-33
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Kauranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 34.3 |
| 2 (CH2) | 18.2 |
| 3 (CH2) | 41.3 |
| 4 (C) | 34.6 |
| 5 (CH) | 42.8 |
| 6 (CH2) | 36.8 |
| 7 (CH) | 64.3 |
| 8 (C) | 145.2 |
| 9 (C) | 214.1 |
| 10 (C) | 53.8 |
| 11 (CH2) | 30 |
| 12 (CH2) | 20.8 |
| 13 (CH) | 40.9 |
| 14 (CH) | 163.1 |
| 15 (C) | 207.2 |
| 16 (CH) | 49.3 |
| 17 (CH2) | 31.6 |
| 18 (CH3) | 33.4 |
| 19 (CH3) | 22.3 |
| 20 (CH3) | 16.5 |
| 1' (C) | 135.2 |
| 2' (CH) | 129.7 |
| 3' (CH) | 129.2 |
| 4' (CH) | 126.6 |
| 5' (CH) | 129.2 |
| 6' (CH) | 129.7 |