Common Name: Lapsanoside A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H30O10/c1-8-5-14(30-11(4)25)17-10(3)22(29)33-21(17)16-9(2)13(6-12(8)16)31-23-20(28)19(27)18(26)15(7-24)32-23/h12-21,23-24,26-28H,1-3,5-7H2,4H3/t12-,13-,14+,15+,16-,17+,18+,19-,20+,21+,23+/m0/s1
InChIKey: InChIKey=CWJDVGSBODWMGX-AJSINDPKSA-N
Formula: C23H30O10
Molecular Weight: 466.479198
Exact Mass: 466.183897
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Fontanel, D., Galtier, C., Debouzy, J.C., Gueiffier, A., Viel, C. Phytochemistry (1999) 51, 999-1004
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 46.5 |
| 2 (CH2) | 35.9 |
| 3 (CH) | 79.7 |
| 4 (C) | 148.8 |
| 5 (CH) | 52.8 |
| 6 (CH) | 78.3 |
| 7 (CH) | 46.7 |
| 8 (CH) | 74.2 |
| 9 (CH2) | 37.4 |
| 10 (C) | 143.3 |
| 11 (C) | 139 |
| 12 (C) | 167.3 |
| 13 (CH2) | 120.9 |
| 14 (CH2) | 117.2 |
| 15 (CH2) | 115.3 |
| 1' (CH) | 100.6 |
| 2' (CH) | 74.4 |
| 3' (CH) | 76.9 |
| 4' (CH) | 70.8 |
| 5' (CH) | 77.2 |
| 6' (CH2) | 61.8 |
| 8a (C) | 171 |
| 8b (CH3) | 19.9 |