Common Name: Tamulamides A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C35H45NO10/c1-20(38)36-19-31-22(39)15-27-30(43-31)17-34(2)33(44-27)18-35(3)32(46-34)13-12-26-29(45-35)16-28-25(41-26)11-10-23-24(42-28)9-8-21(40-23)7-5-4-6-14-37/h4-14,21-33,39H,15-19H2,1-3H3,(H,36,38)/b6-4+,7-5+/t21-,22-,23+,24-,25-,26+,27+,28+,29-,30-,31+,32-,33-,34+,35+/m1/s1
InChIKey: InChIKey=QBNANTHTVCSSKS-PXIDHJHOSA-N
Formula: C35H45N1O10
Molecular Weight: 639.733883
Exact Mass: 639.304347
NMR Solvent: CD2Cl2
MHz:
Calibration:
NMR references: 13C - Truxal, L.T., Bourdelais, A.J., Jacocks, H., Abraham, W.M., Baden, D.G. J Nat Prod (2010) 73, 536-40
Species:
Notes: Family : Polyketides, Type : Polycyclic-ethers; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH3) | 23.1 |
| 2 (C) | 172.7 |
| 3 (CH2) | 40.6 |
| 4 (CH) | 82.6 |
| 5 (CH) | 65.6 |
| 6 (CH2) | 37.1 |
| 7 (CH) | 79.2 |
| 8 (CH) | 77.5 |
| 9 (CH2) | 43.4 |
| 10 (C) | 73.6 |
| 11 (CH) | 79.1 |
| 12 (CH2) | 39.4 |
| 13 (C) | 75.7 |
| 14 (CH) | 75.3 |
| 15 (CH) | 131.5 |
| 16 (CH) | 131.6 |
| 17 (CH) | 80.4 |
| 18 (CH) | 67.4 |
| 19 (CH2) | 38.9 |
| 20 (CH) | 77.7 |
| 21 (CH) | 80.4 |
| 22 (CH) | 132.5 |
| 23 (CH) | 132.1 |
| 24 (CH) | 77.6 |
| 25 (CH) | 76.2 |
| 26 (CH) | 128.7 |
| 27 (CH) | 128.8 |
| 28 (CH) | 74.7 |
| 29 (CH) | 142.3 |
| 30 (CH) | 128.9 |
| 31 (CH) | 151.3 |
| 32 (CH) | 132.6 |
| 33 (CH) | 193.8 |
| 34 (CH3) | 15.6 |
| 35 (CH3) | 17 |