Common Name: 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-3-(4-methoxyphenyl)-
Synonyms: 1H-2-Benzopyran-1-one, 3,4-dihydro-8-hydroxy-3-(4-methoxyphenyl)-
CAS Registry Number:
InChI: InChI=1S/C16H14O4/c1-19-12-7-5-10(6-8-12)14-9-11-3-2-4-13(17)15(11)16(18)20-14/h2-8,14,17H,9H2,1H3
InChIKey: InChIKey=DEFIJGJJJKEYGS-UHFFFAOYSA-N
Formula: C16H14O4
Molecular Weight: 270.280565
Exact Mass: 270.089209
NMR Solvent:
MHz:
Calibration:
NMR references: 13C - Valcic, S., Zapp, J., Becker, H. Phytochemistry (1997) 44, 89-99
Species:
Notes: Family : Isochromans, Type : Isocoumarins; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 169.8 |
| 3 (CH) | 80.7 |
| 4 (CH2) | 35 |
| 5 (CH) | 117.9 |
| 6 (CH) | 136.2 |
| 7 (CH) | 116.4 |
| 8 (C) | 160.1 |
| 9 (C) | 108.6 |
| 10 (C) | 139.4 |
| 1' (C) | 130.1 |
| 2' (CH) | 127.7 |
| 3' (CH) | 114.2 |
| 4' (C) | 162.4 |
| 5' (CH) | 114.2 |
| 6' (CH) | 127.7 |
| 4'a (CH3) | 55.3 |