Common Name: Dendronobiloside C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H44O12/c1-12(2)15-6-4-14(11-37-27-25(35)23(33)21(31)19(9-29)39-27)16-5-3-13(7-17(15)16)10-36-26-24(34)22(32)20(30)18(8-28)38-26/h7,12,15,17-35H,3-6,8-11H2,1-2H3/t15-,17-,18+,19+,20+,21+,22-,23-,24+,25+,26+,27+/m0/s1
InChIKey: InChIKey=VQIXOWSHANMVBC-AVWNUKRNSA-N
Formula: C27H44O12
Molecular Weight: 560.632122
Exact Mass: 560.283277
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Ye, Q., Zhao, W. Planta Med (2002) 68, 723-9
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Cadinanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 136.8 |
| 2 (CH2) | 26.8 |
| 3 (CH2) | 28.9 |
| 4 (C) | 135.5 |
| 5 (CH) | 127.3 |
| 6 (CH) | 40.1 |
| 7 (CH) | 45.2 |
| 8 (CH2) | 21.4 |
| 9 (CH2) | 28.5 |
| 10 (C) | 126.4 |
| 11 (CH) | 26.8 |
| 12 (CH3) | 15.8 |
| 13 (CH3) | 21.8 |
| 14 (CH2) | 73.2 |
| 15 (CH2) | 67.9 |
| 1' (CH) | 103 |
| 2' (CH) | 75.2 |
| 3' (CH) | 78.6 |
| 4' (CH) | 71.7 |
| 5' (CH) | 78.6 |
| 6' (CH2) | 62.9 |
| 1'' (CH) | 103.9 |
| 2'' (CH) | 75.2 |
| 3'' (CH) | 78.6 |
| 4'' (CH) | 71.8 |
| 5'' (CH) | 78.6 |
| 6'' (CH2) | 62.9 |