Common Name: 6alpha-(7'Z-coumaryloxy)eudesm-4(14)-ene
Synonyms: 6alpha-(7'Z-coumaryloxy)eudesm-4(14)-ene
CAS Registry Number:
InChI: InChI=1S/C24H32O3/c1-16(2)20-13-15-24(4)14-5-6-17(3)22(24)23(20)27-21(26)12-9-18-7-10-19(25)11-8-18/h7-12,16,20,22-23,25H,3,5-6,13-15H2,1-2,4H3/b12-9-/t20-,22+,23-,24+/m0/s1
InChIKey: InChIKey=IIZXOWSEQGPRRJ-DSLKVHASSA-N
Formula: C24H32O3
Molecular Weight: 368.50998
Exact Mass: 368.235145
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Chaturvedula, V.S., Farooq, A., Schilling, J.K., Malone, S., Derveld, I., Werkhoven, M.C., Wisse, J.H., Ratsimbason, M., Kingston, D.G. J Nat Prod (2004) 67, 2053-7
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 40.3 |
| 2 (CH2) | 24.3 |
| 3 (CH2) | 42.2 |
| 4 (C) | 146.5 |
| 5 (CH) | 55.9 |
| 6 (CH) | 71.1 |
| 7 (CH) | 49.5 |
| 8 (CH2) | 18.4 |
| 9 (CH2) | 38.2 |
| 10 (C) | 38.3 |
| 11 (CH) | 26.2 |
| 12 (CH3) | 17.6 |
| 13 (CH3) | 21.4 |
| 14 (CH3) | 16.2 |
| 15 (CH2) | 106.7 |
| 6a (C) | 166.6 |
| 6b (CH) | 114.9 |
| 6c (CH) | 143.3 |
| 6d (C) | 127.6 |
| 6e (CH) | 132.4 |
| 6f (CH) | 115 |
| 6g (C) | 156.4 |
| 6h (CH) | 115 |
| 6i (CH) | 132.4 |