Common Name: 4-Methoxy[3,4'-oxybisbenzaldehyde]
Synonyms: 4-Methoxy[3,4'-oxybisbenzaldehyde]
CAS Registry Number:
InChI: InChI=1S/C15H12O4/c1-18-14-7-4-12(10-17)8-15(14)19-13-5-2-11(9-16)3-6-13/h2-10H,1H3
InChIKey: InChIKey=YAYLLPIGVCCHJD-UHFFFAOYSA-N
Formula: C15H12O4
Molecular Weight: 256.253947
Exact Mass: 256.073559
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Gao, K., Jia, Z.J. Phytochemistry (1998) 49, 167-9
Species:
Notes: Family : Aromatics, Type : Biphenyl-ethers; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 147.2 |
| 2 (C) | 151.9 |
| 3 (CH) | 109 |
| 4 (CH) | 127.7 |
| 5 (C) | 129.8 |
| 6 (CH) | 114.2 |
| 1' (C) | 161.9 |
| 2' (CH) | 116 |
| 3' (CH) | 132.5 |
| 4' (C) | 129.8 |
| 5' (CH) | 132.5 |
| 6' (CH) | 116 |
| 2a (CH3) | 56.1 |
| 5a (CH) | 191.1 |
| 4'a (CH) | 191.1 |