Spektraris NMR
Clathrin A
Common Name: Clathrin A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H34O2/c1-17(2)8-5-9-18(3)10-6-11-19(4)14-15-20-12-7-13-21(16-20)22(23)24/h5-6,9-11,16-18,20H,7-8,12-15H2,1-4H3,(H,23,24)/b9-5-,10-6+,19-11+
InChIKey: InChIKey=POOTZJVXDGHNMQ-KFBGXEEASA-N
Formula: C22H34O2
Molecular Weight: 330.504985
Exact Mass: 330.25588
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Capon, R.J., Miller, M., Rooney, F. J Nat Prod (2000) 63, 821-4
Species:
Notes: Family : Terpenoids, Type : Merosesquiterpenoids, Group : Farnesanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
Carbon NMR Peaks
| Position | PPM |
|---|---|
| 1 (CH2) | 28.4 |
| 2 (CH2) | 28.8 |
| 3 (C) | 139.2 |
| 4 (CH) | 124 |
| 5 (CH) | 124.8 |
| 6 (CH) | 137.8 |
| 7 (CH) | 39.7 |
| 8 (CH) | 135.4 |
| 9 (CH) | 127.9 |
| 10 (CH2) | 42 |
| 11 (CH) | 26.9 |
| 12 (CH3) | 22.3 |
| 13 (CH3) | 22.3 |
| 14 (CH3) | 20.6 |
| 15 (CH3) | 15 |
| 1' (CH) | 41.9 |
| 2' (CH) | 142 |
| 3' (C) | 137.4 |
| 4' (CH2) | 24.3 |
| 5' (CH2) | 30.5 |
| 6' (CH2) | 31.1 |
| 3'a (C) | 172.8 |
