Common Name: (11S)-11,17-Dihydroxy-3,4-dimethoxytricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaen-5-yl 6-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C34H40O14/c1-44-31-21-12-17(5-3-4-6-19(35)9-7-16-8-10-22(36)20(21)11-16)30(32(31)45-2)48-34-29(42)28(41)27(40)25(47-34)15-46-33(43)18-13-23(37)26(39)24(38)14-18/h8,10-14,19,25,27-29,34-42H,3-7,9,15H2,1-2H3/t19-,25+,27+,28-,29+,34-/m0/s1
InChIKey: InChIKey=PXTKHOHAJHGCKB-DXXHMWGISA-N
Formula: C34H40O14
Molecular Weight: 672.67432
Exact Mass: 672.241806
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Yaguchi, Y., Sakurai, N., Nagai, M., Inoue, T. Chem Pharm Bull (1988) 36, 1419-24
Species:
Notes: Family : Aromatics, Type : Biphenyl-cyclophanes, Group : Diarylheptanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 126.55 |
| 2 (C) | 128.98 |
| 3 (C) | 148.91 |
| 4 (C) | 145.89 |
| 5 (C) | 149.66 |
| 6 (C) | 130.42 |
| 7 (CH2) | 27.11 |
| 8 (CH2) | 26.32 |
| 9 (CH2) | 23.4 |
| 10 (CH2) | 40.45 |
| 11 (CH) | 67.99 |
| 12 (CH2) | 35.72 |
| 13 (CH2) | 27.99 |
| 14 (C) | 131.04 |
| 15 (CH) | 130.31 |
| 16 (CH) | 116.96 |
| 17 (C) | 153.05 |
| 18 (CH) | 135.08 |
| 19 (CH) | 130.16 |
| 1' (CH) | 105.78 |
| 2' (CH) | 75.65 |
| 3' (CH) | 78.2 |
| 4' (CH) | 71.08 |
| 5' (CH) | 75.73 |
| 6' (CH2) | 63.9 |
| 1'' (C) | 167.14 |
| 2'' (C) | 121.22 |
| 3'' (CH) | 110.23 |
| 4'' (C) | 147.42 |
| 5'' (C) | 140.79 |
| 6'' (C) | 147.42 |
| 7'' (CH) | 110.23 |
| 3a (CH3) | 61.1 |
| 4a (CH3) | 61.57 |