Common Name: Hyperinone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C19H20O8/c20-8-13-16(24)17(25)18(26)19(27-13)14-11(21)6-10(7-12(14)22)15(23)9-4-2-1-3-5-9/h1-7,13,16-22,24-26H,8H2/t13-,16-,17+,18-,19+/m1/s1
InChIKey: InChIKey=IZLOXVHOHPOUQD-SFKBXODTSA-N
Formula: C19H20O8
Molecular Weight: 376.358037
Exact Mass: 376.115818
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Gamiotea-Turro, D., Cuesta-Rubio, O., Prieto-Gonzalez, S., De Simone, F., Passi, S., Rastrelli, L. J Nat Prod (2004) 67, 869-71
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 142.1 |
| 2 (CH) | 127.6 |
| 3 (CH) | 129.6 |
| 4 (CH) | 128.4 |
| 5 (CH) | 129.6 |
| 6 (CH) | 127.6 |
| 1' (C) | 143.8 |
| 2' (CH) | 107.4 |
| 3' (C) | 158.4 |
| 4' (C) | 111.6 |
| 5' (C) | 158.4 |
| 6' (CH) | 107.4 |
| 7' (C) | 193 |
| 1'' (CH) | 76.8 |
| 2'' (CH) | 73.7 |
| 3'' (CH) | 79.9 |
| 4'' (CH) | 71.3 |
| 5'' (CH) | 82.5 |
| 6'' (CH2) | 62.4 |