Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H28O8/c1-12-5-6-17(28-15(4)25)13(2)10-19-20(14(3)21(26)29-19)18(9-12)30-22(27)16(11-24)7-8-23/h5,7,10,17-20,23-24H,3,6,8-9,11H2,1-2,4H3/b12-5+,13-10-,16-7-/t17-,18+,19+,20+/m0/s1
InChIKey: InChIKey=XYPJAWWDSQFSQA-VMCYIVQPSA-N
Formula: C22H28O8
Molecular Weight: 420.45377
Exact Mass: 420.178418
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Pacciaroni, A.D., Sosa, V.E., Espinar, L.A., Oberti, J.C. Phytochemistry (1995) 39, 127-31
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Germacranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 125.2 |
| 2 (CH2) | 29.4 |
| 3 (CH) | 77.9 |
| 4 (C) | 137.2 |
| 5 (CH) | 126.5 |
| 6 (CH) | 76 |
| 7 (CH) | 48.5 |
| 8 (CH) | 76.4 |
| 9 (CH2) | 43.4 |
| 10 (C) | 137.1 |
| 11 (C) | 135.5 |
| 12 (C) | 165.6 |
| 13 (CH2) | 125.2 |
| 14 (CH3) | 19.4 |
| 15 (CH3) | 23.1 |
| 3a (C) | 172.5 |
| 3b (CH3) | 21.2 |
| 8a (C) | 169.8 |
| 8b (C) | 131.2 |
| 8c (CH) | 145.6 |
| 8d (CH2) | 56.7 |
| 8ba (CH2) | 59 |