Common Name: Globulixanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H22O5/c1-13(2)6-5-10-23(3)11-9-14-18(28-23)12-16(25)22-19(14)21(26)20-15(24)7-4-8-17(20)27-22/h4,6-9,11-12,24-25H,5,10H2,1-3H3/t23-/m0/s1
InChIKey: InChIKey=DZEKDJJYJJYEFB-QHCPKHFHSA-N
Formula: C23H22O5
Molecular Weight: 378.418647
Exact Mass: 378.146724
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Nkengfack, A.E., Mkounga, P., Fomum, Z.T., Meyer, M., Bodo, B. J Nat Prod (2002) 65, 734-6
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 161.9 |
| 2 (CH) | 110.1 |
| 3 (CH) | 135.8 |
| 4 (CH) | 106.3 |
| 4a (C) | 155.7 |
| 5 (C) | 153.4 |
| 6 (CH) | 102.4 |
| 7 (C) | 137.1 |
| 8 (C) | 109.1 |
| 8a (C) | 119.5 |
| 9 (C) | 183.7 |
| 9a (C) | 108.6 |
| 10a (C) | 151.4 |
| 1' (CH) | 123.6 |
| 2' (CH) | 131.7 |
| 3' (C) | 79.6 |
| 4' (CH3) | 25.7 |
| 5' (CH2) | 40.4 |
| 6' (CH2) | 22.8 |
| 7' (CH) | 121.2 |
| 8' (C) | 132.2 |
| 9' (CH3) | 17.7 |
| 10' (CH3) | 25.6 |