Common Name: Cudratricusxanthone K
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H26O6/c1-12(2)6-8-14-21(27)20-22(28)16-10-17(25)18(26)11-19(16)30-24(20)15(23(14)29-5)9-7-13(3)4/h6-7,10-11,25-27H,8-9H2,1-5H3
InChIKey: InChIKey=NHJUGTUGZNCOKP-UHFFFAOYSA-N
Formula: C24H26O6
Molecular Weight: 410.460551
Exact Mass: 410.172939
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Hwang, J.H., Hong, S.S., Han, X.H., Hwang, J.S., Lee, D., Lee, H., Yun, Y.P., Kim, Y., Ro, J.S., Hwang, B.Y. J Nat Prod (2007) 70, 1207-9
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 158.6 |
| 2 (C) | 116.3 |
| 3 (C) | 162.9 |
| 4 (C) | 112.6 |
| 4a (C) | 153.1 |
| 5 (CH) | 102.7 |
| 6 (C) | 153.8 |
| 7 (C) | 143.3 |
| 8 (CH) | 108.3 |
| 8a (C) | 112.7 |
| 9 (C) | 180.5 |
| 9a (C) | 105.1 |
| 10a (C) | 152.1 |
| 1' (CH2) | 22.2 |
| 2' (CH) | 122.9 |
| 3' (C) | 131.1 |
| 4' (CH3) | 17.2 |
| 5' (CH3) | 24.9 |
| 1'' (CH2) | 22.4 |
| 2'' (CH) | 122.9 |
| 3'' (C) | 130.8 |
| 4'' (CH3) | 17.1 |
| 5'' (CH3) | 24.9 |
| 3a (CH3) | 61.4 |