Common Name: 50597-93-8
Synonyms: 50597-93-8
CAS Registry Number:
InChI: InChI=1S/C18H14O6/c1-18(2)6-5-8-12(24-18)7-11(20)13-14(21)9-3-4-10(19)15(22)17(9)23-16(8)13/h3-7,19-20,22H,1-2H3
InChIKey: InChIKey=FSTNFJKGRSHPBO-UHFFFAOYSA-N
Formula: C18H14O6
Molecular Weight: 326.300846
Exact Mass: 326.079038
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Wu, Q.L., Wang, S.P., Du, L.J., Yang, J.S., Xiao, P.G. Phytochemistry (1998) 49, 1395-402
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 162.7 |
| 2 (CH) | 98.7 |
| 3 (C) | 160 |
| 4 (C) | 102.6 |
| 4a (C) | 151.6 |
| 5 (C) | 132.9 |
| 6 (C) | 152.7 |
| 7 (CH) | 115.4 |
| 8 (CH) | 116.5 |
| 8a (C) | 113.3 |
| 9 (C) | 180.4 |
| 9a (C) | 101.3 |
| 10a (C) | 146.4 |
| 1' (CH) | 113.7 |
| 2' (CH) | 127.6 |
| 3' (C) | 78.5 |
| 4' (CH3) | 28.2 |
| 5' (CH3) | 28.2 |