Common Name: Umbilicaxanthone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H26O6/c1-12(2)6-8-14-10-18(29-5)24-20(21(14)27)22(28)19-15(9-7-13(3)4)16(25)11-17(26)23(19)30-24/h6-7,10-11,25-27H,8-9H2,1-5H3
InChIKey: InChIKey=HNEVVGJOTZRWPZ-UHFFFAOYSA-N
Formula: C24H26O6
Molecular Weight: 410.460551
Exact Mass: 410.172939
NMR Solvent:
MHz:
Calibration:
NMR references: 13C - Rezanka, T., Jachymova, J., Dembitsky, V.M. Phytochemistry (2003) 62, 607-12
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 151 |
| 2 (C) | 117.8 |
| 3 (CH) | 119.4 |
| 4 (C) | 143.2 |
| 4a (C) | 141.3 |
| 5 (C) | 135.7 |
| 6 (CH) | 146.2 |
| 7 (C) | 102.4 |
| 8 (C) | 157.2 |
| 8a (C) | 117.6 |
| 9 (C) | 129.6 |
| 9a (C) | 183.1 |
| 10a (C) | 114.6 |
| 1' (CH2) | 25.4 |
| 2' (CH) | 123.8 |
| 3' (C) | 130.9 |
| 4' (CH3) | 18.4 |
| 5' (CH3) | 26.2 |
| 1'' (CH3) | 56.4 |
| 1''' (CH2) | 26.1 |
| 2''' (CH) | 124.8 |
| 3''' (C) | 132 |
| 4''' (CH3) | 18 |
| 5''' (CH3) | 25.9 |