Common Name: 1,3,5-Trihydroxy-4,8-diprenylxanthone
Synonyms: 1,3,5-Trihydroxy-4,8-diprenylxanthone
CAS Registry Number:
InChI: InChI=1S/C23H24O5/c1-12(2)5-7-14-8-10-16(24)23-19(14)21(27)20-18(26)11-17(25)15(22(20)28-23)9-6-13(3)4/h5-6,8,10-11,24-26H,7,9H2,1-4H3
InChIKey: InChIKey=UKDOKBDBEGCYLQ-UHFFFAOYSA-N
Formula: C23H24O5
Molecular Weight: 380.434528
Exact Mass: 380.162374
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Nguyen, L.H., Vo, H.T., Pham, H.D., Connolly, J.D., Harrison, L.J. Phytochemistry (2003) 63, 467-70
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 162.9 |
| 2 (CH) | 98.9 |
| 3 (C) | 164 |
| 4 (C) | 107.4 |
| 4a (C) | 155.3 |
| 5 (C) | 145.7 |
| 6 (CH) | 121.2 |
| 7 (CH) | 126.2 |
| 8 (C) | 135.3 |
| 8a (C) | 119.8 |
| 9 (C) | 184.7 |
| 9a (C) | 104.8 |
| 10a (C) | 148 |
| 1' (CH2) | 22.5 |
| 2' (CH) | 124 |
| 3' (C) | 132.6 |
| 4' (CH3) | 18.41 |
| 5' (CH3) | 26.3 |
| 1'' (CH2) | 34 |
| 2'' (CH) | 125 |
| 3'' (C) | 132.1 |
| 4'' (CH3) | 18.38 |
| 5'' (CH3) | 26.3 |