Common Name: 776325-66-7
Synonyms: 776325-66-7
CAS Registry Number:
InChI: InChI=1S/C23H24O6/c1-11(2)5-7-13-14(8-6-12(3)4)19(26)21(28)23-17(13)20(27)18-15(24)9-10-16(25)22(18)29-23/h5-6,9-10,24-26,28H,7-8H2,1-4H3
InChIKey: InChIKey=SHZLJVCQGYKZLS-UHFFFAOYSA-N
Formula: C23H24O6
Molecular Weight: 396.433933
Exact Mass: 396.157289
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Chanmahasathien, W., Li, Y., Satake, M., Oshima, Y., Ruangrungsi, N., Ohizumi, Y. Phytochemistry (2003) 64, 981-6
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 155.1 |
| 2 (CH) | 109.8 |
| 3 (CH) | 122.6 |
| 4 (C) | 137.2 |
| 4a (C) | 143.8 |
| 5 (C) | 131.6 |
| 6 (C) | 151.1 |
| 7 (C) | 135.1 |
| 8 (C) | 127.1 |
| 8a (C) | 112.2 |
| 9 (C) | 184.5 |
| 9a (C) | 110.1 |
| 10a (C) | 146.3 |
| 1' (CH2) | 25.6 |
| 2' (CH) | 124 |
| 3' (C) | 131.2 |
| 4' (CH3) | 18.4 |
| 5' (CH3) | 25.9 |
| 1'' (CH2) | 29.5 |
| 2'' (CH) | 125.4 |
| 3'' (C) | 132.2 |
| 4'' (CH3) | 18.2 |
| 5'' (CH3) | 25.9 |