Common Name: Cowagarcinone D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C28H30O6/c1-15(2)7-6-11-28(5)12-10-18-23-21(14-20(30)27(18)34-28)33-22-13-19(29)17(9-8-16(3)4)25(31)24(22)26(23)32/h7-8,10,12-14,29-31H,6,9,11H2,1-5H3
InChIKey: InChIKey=QAHKVGNDCXMIJR-UHFFFAOYSA-N
Formula: C28H30O6
Molecular Weight: 462.535257
Exact Mass: 462.204239
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Mahabusarakam, W., Chairerk, P., Taylor, W.C. Phytochemistry (2005) 66, 1148-53
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 160.47 |
| 2 (C) | 108.36 |
| 3 (C) | 161.73 |
| 4 (CH) | 93.42 |
| 4a (C) | 155.34 |
| 5 (CH) | 102.32 |
| 6 (C) | 150.77 |
| 7 (C) | 136.82 |
| 8 (C) | 119.58 |
| 8a (C) | 108.55 |
| 9 (C) | 182.55 |
| 9a (C) | 103.78 |
| 10a (C) | 153.03 |
| 1' (CH2) | 21.45 |
| 2' (CH) | 121.39 |
| 3' (C) | 135.86 |
| 4' (CH3) | 17.93 |
| 5' (CH3) | 25.86 |
| 1'' (CH) | 121.44 |
| 2'' (CH) | 131.45 |
| 3'' (C) | 79.39 |
| 4'' (CH3) | 25.65 |
| 5'' (CH2) | 40.38 |
| 6'' (CH2) | 22.77 |
| 7'' (CH) | 123.65 |
| 8'' (C) | 132.16 |
| 9'' (CH3) | 25.67 |
| 10'' (CH3) | 17.67 |