Common Name: Bangangxanthone A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H22O6/c1-12(2)5-4-9-23(3)10-8-13-17(29-23)11-16(26)19-20(27)18-14(24)6-7-15(25)22(18)28-21(13)19/h5-8,10-11,24-26H,4,9H2,1-3H3/t23-/m0/s1
InChIKey: InChIKey=HFJSQHGZXHTCLI-QHCPKHFHSA-N
Formula: C23H22O6
Molecular Weight: 394.418052
Exact Mass: 394.141638
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Lannang, A.M., Komguem, J., Ngninzeko, F.N., Tangmouo, J.G., Lontsi, D., Ajaz, A., Choudhary, M.I., Ranjit, R., Devkota, K.P., Sondengam, B.L. Phytochemistry (2005) 66, 2351-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 162.1 |
| 2 (CH) | 99.8 |
| 3 (C) | 162.9 |
| 4 (C) | 101 |
| 4a (C) | 151 |
| 5 (C) | 135.5 |
| 6 (CH) | 123.5 |
| 7 (CH) | 110.3 |
| 8 (C) | 154.2 |
| 8a (C) | 107.3 |
| 9 (C) | 184.3 |
| 9a (C) | 102.3 |
| 10a (C) | 142.7 |
| 1' (CH) | 114.8 |
| 2' (CH) | 123.5 |
| 3' (C) | 81.1 |
| 4' (CH3) | 27.1 |
| 5' (CH2) | 41.6 |
| 6' (CH2) | 22.6 |
| 7' (CH) | 126.8 |
| 8' (C) | 132.1 |
| 9' (CH3) | 17.6 |
| 10' (CH3) | 25.6 |