Common Name: Bangangxanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C18H16O5/c1-9(2)6-7-10-8-12(20)18-15(16(10)21)17(22)14-11(19)4-3-5-13(14)23-18/h3-6,8,19-21H,7H2,1-2H3
InChIKey: InChIKey=ZXAITARLYXDVLJ-UHFFFAOYSA-N
Formula: C18H16O5
Molecular Weight: 312.317323
Exact Mass: 312.099774
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Lannang, A.M., Komguem, J., Ngninzeko, F.N., Tangmouo, J.G., Lontsi, D., Ajaz, A., Choudhary, M.I., Ranjit, R., Devkota, K.P., Sondengam, B.L. Phytochemistry (2005) 66, 2351-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 151.3 |
| 2 (C) | 123.3 |
| 3 (CH) | 124.4 |
| 4 (C) | 135.1 |
| 4a (C) | 141 |
| 5 (CH) | 106.8 |
| 6 (CH) | 137.4 |
| 7 (CH) | 111.1 |
| 8 (C) | 161.7 |
| 8a (C) | 110.6 |
| 9 (C) | 186.2 |
| 9a (C) | 107.8 |
| 10a (C) | 155.7 |
| 1' (CH2) | 26.8 |
| 2' (CH) | 121.2 |
| 3' (C) | 133.9 |
| 4' (CH3) | 17.8 |
| 5' (CH3) | 25.8 |