Common Name: 2,3,4-Trimethoxy-6-hydroxy-9H-xanthene-9-one
Synonyms: 2,3,4-Trimethoxy-6-hydroxy-9H-xanthene-9-one
CAS Registry Number:
InChI: InChI=1S/C16H14O6/c1-19-12-7-10-13(18)9-5-4-8(17)6-11(9)22-14(10)16(21-3)15(12)20-2/h4-7,17H,1-3H3
InChIKey: InChIKey=CVRGANONEPHAFP-UHFFFAOYSA-N
Formula: C16H14O6
Molecular Weight: 302.279374
Exact Mass: 302.079038
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Tanaka, N., Takaishi, Y. Chem Pharm Bull (2007) 55, 19-21
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 102 |
| 2 (C) | 150.8 |
| 3 (C) | 148.6 |
| 4 (C) | 142.4 |
| 4a (C) | 146.3 |
| 5 (CH) | 103.4 |
| 6 (C) | 165.5 |
| 7 (CH) | 115.3 |
| 8 (CH) | 128.9 |
| 8a (C) | 114.9 |
| 9 (C) | 176.1 |
| 9a (C) | 118.9 |
| 10a (C) | 158.9 |
| 1' (CH3) | 56.3 |
| 1'' (CH3) | 61.6 |
| 1''' (CH3) | 62.2 |