Common Name: Morinthone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C31H44O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-25-23-24-27-29(32)26-21-18-19-22-28(26)34-31(27)30(25)33-2/h18-19,21-24H,3-17,20H2,1-2H3
InChIKey: InChIKey=LZEKDUYFZGDDMP-UHFFFAOYSA-N
Formula: C31H44O3
Molecular Weight: 464.680421
Exact Mass: 464.329045
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Siddiqui, B.S., Sattar, F.A., Begum, S., Gulzar, T., Ahmad, F. Arch Pharm Res (2007) 30, 793-8
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 125.9 |
| 2 (CH) | 121.7 |
| 3 (C) | 133.2 |
| 4 (C) | 150 |
| 4a (C) | 148 |
| 5 (CH) | 114.2 |
| 6 (CH) | 127.2 |
| 7 (CH) | 134.1 |
| 8 (CH) | 126.8 |
| 8a (C) | 124.5 |
| 9 (C) | 182 |
| 9a (C) | 127.1 |
| 10a (C) | 157.9 |
| 1' (CH2) | 34.2 |
| 2' (CH2) | 22 |
| 3' (CH2) | 22 |
| 4' (CH2) | 22 |
| 5' (CH2) | 22 |
| 6' (CH2) | 22 |
| 7' (CH2) | 22 |
| 8' (CH2) | 22 |
| 9' (CH2) | 22 |
| 10' (CH2) | 22 |
| 11' (CH2) | 22 |
| 12' (CH2) | 22 |
| 13' (CH2) | 22 |
| 14' (CH2) | 22 |
| 15' (CH2) | 22 |
| 16' (CH2) | 23 |
| 17' (CH3) | 14.1 |
| 1'' (CH3) | 61.5 |