Common Name: Cudraflavanone D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)5-7-15-9-17(19(27)10-18(15)26)22-12-21(29)24-23(31-22)11-20(28)16(25(24)30)8-6-14(3)4/h5-6,9-11,22,26-28,30H,7-8,12H2,1-4H3/t22-/m0/s1
InChIKey: InChIKey=XLHAGJGNSIEVFB-QFIPXVFZSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Zou, Y.S., Hou, A.J., Zhu, G.F. Chem Biodivers (2005) 2, 131-8
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 75.8 |
| 3 (CH2) | 43.1 |
| 4 (C) | 198.3 |
| 5 (C) | 162.7 |
| 6 (C) | 109.2 |
| 7 (C) | 165.1 |
| 8 (CH) | 95.7 |
| 9 (C) | 162.9 |
| 10 (C) | 103.5 |
| 1' (C) | 117.6 |
| 2' (C) | 154.5 |
| 3' (CH) | 103.8 |
| 4' (C) | 157 |
| 5' (C) | 120.6 |
| 6' (CH) | 129.4 |
| 1'' (CH2) | 22 |
| 2'' (CH) | 124.1 |
| 3'' (C) | 131.5 |
| 4'' (CH3) | 18.2 |
| 5'' (CH3) | 26.3 |
| 5'a (CH2) | 28.9 |
| 5'b (CH) | 124.6 |
| 5'c (C) | 132.4 |
| 5'd (CH3) | 26.3 |
| 5'e (CH3) | 18.2 |