Common Name: 6-Hydroxy-3,5-dimethoxy-1-[ (6-O-b-d-xylopyranosyl-b-d-glucopyranosyl)oxy ]-9H-xanthen-9-one
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O15/c1-35-9-5-13-16(17(29)10-3-4-11(27)24(36-2)23(10)39-13)14(6-9)40-26-22(34)20(32)19(31)15(41-26)8-38-25-21(33)18(30)12(28)7-37-25/h3-6,12,15,18-22,25-28,30-34H,7-8H2,1-2H3/t12-,15-,18+,19-,20+,21-,22-,25+,26-/m1/s1
InChIKey: InChIKey=BZANMTQRFMHZKS-IAMAXPBGSA-N
Formula: C26H30O15
Molecular Weight: 582.50843
Exact Mass: 582.15847
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Rana, V.S., Rawat, M.S. Chem Biodivers (2005) 2, 1310-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 160.7 |
| 2 (CH) | 102 |
| 3 (C) | 165 |
| 4 (CH) | 95.9 |
| 4a (C) | 158.6 |
| 5 (C) | 146.5 |
| 6 (C) | 148.3 |
| 7 (CH) | 123.4 |
| 8 (CH) | 113.4 |
| 8a (C) | 118.3 |
| 9 (C) | 176.2 |
| 9a (C) | 108.9 |
| 10a (C) | 149.7 |
| 1' (CH) | 105.8 |
| 2' (CH) | 75.1 |
| 3' (CH) | 77.7 |
| 4' (CH) | 71.4 |
| 5' (CH) | 77.9 |
| 6' (CH2) | 70.4 |
| 1'' (CH) | 106.6 |
| 2'' (CH) | 75 |
| 3'' (CH) | 78.2 |
| 4'' (CH) | 71.1 |
| 5'' (CH2) | 67.2 |
| 3a (CH3) | 56 |
| 5a (CH3) | 61.5 |