Common Name: SCHEMBL2053786
Synonyms: SCHEMBL2053786
CAS Registry Number:
InChI: InChI=1S/C24H24O6/c1-12(2)5-7-14-15(24(28)29)9-10-18-20(14)23(27)21-19(30-18)11-17(25)16(22(21)26)8-6-13(3)4/h5-6,9-11,25-26H,7-8H2,1-4H3,(H,28,29)
InChIKey: InChIKey=PMZNKPZOEBJGNV-UHFFFAOYSA-N
Formula: C24H24O6
Molecular Weight: 408.444669
Exact Mass: 408.157289
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Gopalakrishnan, G., Balaganesan, B. Fitoterapia (2000) 71, 607-9
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 160 |
| 2 (C) | 115 |
| 3 (C) | 155.1 |
| 4 (CH) | 92.8 |
| 4a (C) | 148.4 |
| 5 (CH) | 131.1 |
| 6 (CH) | 121 |
| 7 (C) | 108.3 |
| 8 (C) | 117.1 |
| 8a (C) | 132.3 |
| 9 (C) | 182.7 |
| 9a (C) | 109.3 |
| 10a (C) | 150.8 |
| 1' (CH2) | 21.3 |
| 2' (CH) | 121.1 |
| 3' (C) | 133.4 |
| 4' (CH3) | 17.7 |
| 5' (CH3) | 27.3 |
| 1'' (C) | 161.6 |
| 1''' (CH2) | 22.4 |
| 2''' (CH) | 121.9 |
| 3''' (C) | 136.4 |
| 4''' (CH3) | 17.7 |
| 5''' (CH3) | 25.7 |