Common Name: Galtamycinone
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H22O8/c1-9-5-14-13(16(26)6-9)7-15-20(24(14)31)23(30)12-4-3-11(22(29)19(12)25(15)32)18-8-17(27)21(28)10(2)33-18/h3-7,10,17-18,21,26-29,31H,8H2,1-2H3/t10-,17-,18-,21-/m1/s1
InChIKey: InChIKey=PBTVAODWGBKPII-BOEKQVJSSA-N
Formula: C25H22O8
Molecular Weight: 450.438333
Exact Mass: 450.131468
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Stroch, K., Zeeck, A., Antal, N., Fiedler, H.P. J Antibiot (2005) 58, 103-10
Species:
Notes: Family : Aromatics, Type : Tetracyclines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 157.7 |
| 2 (CH) | 117.1 |
| 3 (C) | 142.1 |
| 4 (CH) | 115.5 |
| 4a (C) | 129.9 |
| 5 (C) | 164 |
| 5a (C) | 109.9 |
| 6 (C) | 187 |
| 6a (C) | 133.3 |
| 7 (CH) | 118.9 |
| 8 (CH) | 133.4 |
| 9 (C) | 138.6 |
| 10 (C) | 159.6 |
| 10a (C) | 116.9 |
| 11 (C) | 188.4 |
| 11a (C) | 126.4 |
| 12 (CH) | 118 |
| 12a (C) | 125.9 |
| 1' (CH) | 72.2 |
| 2' (CH2) | 41.1 |
| 3' (CH) | 73.5 |
| 4' (CH) | 78.7 |
| 5' (CH) | 77.5 |
| 6' (CH3) | 19 |
| 3a (CH3) | 22.2 |