Common Name: Mangiferin
Synonyms: Mangiferin
CAS Registry Number:
InChI: InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2/t11-,15-,17+,18-,19+/m1/s1
InChIKey: InChIKey=AEDDIBAIWPIIBD-ZJKJAXBQSA-N
Formula: C19H18O11
Molecular Weight: 422.34037
Exact Mass: 422.084911
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Faizi, S., Zikr-Ur-Rehman, S., Ali, M., Naz, A. Magn Reson Chem (2006) 44, 838-44
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 163.21 |
| 2 (C) | 108.8 |
| 3 (C) | 165.29 |
| 4 (CH) | 94.41 |
| 4a (C) | 157.62 |
| 5 (CH) | 103.46 |
| 6 (C) | 156.05 |
| 7 (C) | 145.51 |
| 8 (CH) | 109.35 |
| 8a (C) | 113.26 |
| 9 (C) | 180.38 |
| 9a (C) | 102.9 |
| 10a (C) | 152.14 |
| 1' (CH) | 75.62 |
| 2' (CH) | 72.06 |
| 3' (CH) | 80.66 |
| 4' (CH) | 72.97 |
| 5' (CH) | 82.93 |
| 6' (CH2) | 62.89 |