Common Name: 2β-D-Glucopyranosyl-1-hydroxy-3,6,7-trimethoxy-9H- xanthen-9-one
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H24O11/c1-29-10-4-8-9(5-11(10)30-2)32-13-6-12(31-3)16(19(26)15(13)17(8)24)22-21(28)20(27)18(25)14(7-23)33-22/h4-6,14,18,20-23,25-28H,7H2,1-3H3/t14-,18-,20+,21-,22+/m1/s1
InChIKey: InChIKey=QDUILKKCTDKICD-UREBWEGCSA-N
Formula: C22H24O11
Molecular Weight: 464.420222
Exact Mass: 464.131862
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Faizi, S., Zikr-Ur-Rehman, S., Ali, M., Naz, A. Magn Reson Chem (2006) 44, 838-44
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 161 |
| 2 (C) | 110.04 |
| 3 (C) | 164.01 |
| 4 (CH) | 90.13 |
| 4a (C) | 153.01 |
| 5 (CH) | 100.15 |
| 6 (C) | 156.45 |
| 7 (C) | 147.51 |
| 8 (CH) | 104.98 |
| 8a (C) | 113.46 |
| 9 (C) | 178.79 |
| 9a (C) | 104.98 |
| 10a (C) | 157.7 |
| 1' (CH) | 74.8 |
| 2' (CH) | 71.63 |
| 3' (CH) | 81.07 |
| 4' (CH) | 72.55 |
| 5' (CH) | 83.19 |
| 6' (CH2) | 63.56 |
| 3a (CH3) | 56.39 |
| 6a (CH3) | 55.94 |
| 7a (CH3) | 55.94 |