Common Name: Parvixanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H26O7/c1-12(2)5-7-15-20-18(10-17(27)24(15)30-4)31-19-9-16(26)14(8-6-13(3)11-25)22(28)21(19)23(20)29/h5-6,9-10,25-28H,7-8,11H2,1-4H3/b13-6-
InChIKey: InChIKey=RKFDQABSSOQDOZ-MLPAPPSSSA-N
Formula: C24H26O7
Molecular Weight: 426.459956
Exact Mass: 426.167853
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Xu, Y.J., Lai, Y.H., Imiyabir, Z., Goh, S.H. J Nat Prod (2001) 64, 1191-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 162.9 |
| 2 (C) | 111.7 |
| 3 (C) | 163.8 |
| 4 (CH) | 94.4 |
| 4a (C) | 157.1 |
| 5 (CH) | 103.2 |
| 6 (C) | 157.8 |
| 7 (C) | 145.5 |
| 8 (C) | 139.4 |
| 8a (C) | 113.2 |
| 9 (C) | 183.5 |
| 9a (C) | 104.8 |
| 10a (C) | 155.9 |
| 1' (CH2) | 21.8 |
| 2' (CH) | 125.8 |
| 3' (C) | 136.9 |
| 4' (CH2) | 61.6 |
| 5' (CH3) | 21.5 |
| 1'' (CH2) | 26.5 |
| 2'' (CH) | 125.4 |
| 3'' (C) | 139.1 |
| 4'' (CH3) | 17.4 |
| 5'' (CH3) | 25.3 |
| 7a (CH3) | 60.9 |