Common Name: Parvixanthone C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H26O7/c1-12(2)16(26)8-6-13(3)5-7-15-21-20(11-18(28)24(15)30-4)31-19-10-14(25)9-17(27)22(19)23(21)29/h5,9-11,16,25-28H,1,6-8H2,2-4H3/b13-5+
InChIKey: InChIKey=PNSUKASXPDTEFK-WLRTZDKTSA-N
Formula: C24H26O7
Molecular Weight: 426.459956
Exact Mass: 426.167853
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Xu, Y.J., Lai, Y.H., Imiyabir, Z., Goh, S.H. J Nat Prod (2001) 64, 1191-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 165.1 |
| 2 (CH) | 98.9 |
| 3 (C) | 165.6 |
| 4 (CH) | 94 |
| 4a (C) | 158.2 |
| 5 (CH) | 103 |
| 6 (C) | 157.7 |
| 7 (C) | 144.8 |
| 8 (C) | 138.4 |
| 8a (C) | 110.4 |
| 9 (C) | 182.9 |
| 9a (C) | 103.9 |
| 10a (C) | 156.4 |
| 1' (CH2) | 27 |
| 2' (CH) | 124.8 |
| 3' (C) | 149.5 |
| 4' (CH2) | 36.7 |
| 5' (CH2) | 34.8 |
| 6' (CH) | 75.4 |
| 7' (C) | 135.5 |
| 8' (CH2) | 112.1 |
| 9' (CH3) | 16.9 |
| 10' (CH3) | 18 |
| 7a (CH3) | 61.5 |