Common Name: Parvixanthone F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H24O7/c1-12(2)6-5-7-13(3)16(26)10-15-21-20(11-18(28)24(15)30-4)31-19-9-14(25)8-17(27)22(19)23(21)29/h6-9,11,25,27-28H,5,10H2,1-4H3/b13-7+
InChIKey: InChIKey=FZQZHJBZPIBKGW-NTUHNPAUSA-N
Formula: C24H24O7
Molecular Weight: 424.444074
Exact Mass: 424.152203
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Xu, Y.J., Lai, Y.H., Imiyabir, Z., Goh, S.H. J Nat Prod (2001) 64, 1191-5
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 164.6 |
| 2 (CH) | 98.8 |
| 3 (C) | 165.5 |
| 4 (CH) | 94 |
| 4a (C) | 158.1 |
| 5 (CH) | 103.3 |
| 6 (C) | 157.3 |
| 7 (C) | 145.3 |
| 8 (C) | 137.9 |
| 8a (C) | 110.2 |
| 9 (C) | 182.3 |
| 9a (C) | 103.6 |
| 10a (C) | 156 |
| 1' (CH2) | 38.2 |
| 2' (C) | 197.2 |
| 3' (C) | 137.9 |
| 4' (CH) | 132.1 |
| 5' (CH2) | 28.5 |
| 6' (CH) | 125.9 |
| 7' (C) | 132.3 |
| 8' (CH3) | 24.9 |
| 9' (CH3) | 25.8 |
| 10' (CH3) | 17.8 |
| 7a (CH3) | 61.6 |