Common Name: Cratoxyarborenone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H24O6/c1-11(2)5-7-13-15(24)9-17(26)23-19(13)22(28)20-18(29-23)10-16(25)14(21(20)27)8-6-12(3)4/h5-6,9-10,24-27H,7-8H2,1-4H3
InChIKey: InChIKey=AVGUAOZYPIBDIZ-UHFFFAOYSA-N
Formula: C23H24O6
Molecular Weight: 396.433933
Exact Mass: 396.157289
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Seo, E.K., Kim, N.C., Wani, M.C., Wall, M.E., Navarro, H.A., Burgess, J.P., Kawanishi, K., Kardono, L.B., Riswan, S., Rose, W.C., Fairchild, C.R., Farnsworth, N.R., Kinghorn, A.D. J Nat Prod (2002) 65, 299-305
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 161.7 |
| 2 (C) | 110.8 |
| 3 (C) | 162.7 |
| 4 (CH) | 92.9 |
| 4a (C) | 155.7 |
| 5 (C) | 153.5 |
| 6 (CH) | 101.1 |
| 7 (C) | 141.6 |
| 8 (C) | 112.1 |
| 8a (C) | 129.1 |
| 9 (C) | 183.2 |
| 9a (C) | 103.7 |
| 10a (C) | 152.3 |
| 1' (CH2) | 25.9 |
| 2' (CH) | 123.5 |
| 3' (C) | 131.3 |
| 4' (CH3) | 17.9 |
| 5' (CH3) | 26 |
| 1'' (CH2) | 26.3 |
| 2'' (CH) | 124.4 |
| 3'' (C) | 131.3 |
| 4'' (CH3) | 25.9 |
| 5'' (CH3) | 18.3 |