Common Name: Cratoxyarborenone C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O6/c1-13(2)7-9-15-17(26)11-19-22(23(15)27)24(28)21-16(10-8-14(3)4)18(29-5)12-20(30-6)25(21)31-19/h7-8,11-12,26-27H,9-10H2,1-6H3
InChIKey: InChIKey=PGWGLEHDWSDHBH-UHFFFAOYSA-N
Formula: C25H28O6
Molecular Weight: 424.487168
Exact Mass: 424.188589
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Seo, E.K., Kim, N.C., Wani, M.C., Wall, M.E., Navarro, H.A., Burgess, J.P., Kawanishi, K., Kardono, L.B., Riswan, S., Rose, W.C., Fairchild, C.R., Farnsworth, N.R., Kinghorn, A.D. J Nat Prod (2002) 65, 299-305
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 160.7 |
| 2 (C) | 108.6 |
| 3 (C) | 161.5 |
| 4 (CH) | 93.1 |
| 4a (C) | 155 |
| 5 (C) | 158.1 |
| 6 (CH) | 98.3 |
| 7 (C) | 144 |
| 8 (C) | 111.9 |
| 8a (C) | 137.3 |
| 9 (C) | 182.1 |
| 9a (C) | 103.8 |
| 10a (C) | 155.4 |
| 1' (CH2) | 21.5 |
| 2' (CH) | 121.5 |
| 3' (C) | 135.4 |
| 4' (CH3) | 18.1 |
| 5' (CH3) | 25.8 |
| 1'' (CH2) | 26.2 |
| 2'' (CH) | 123.3 |
| 3'' (C) | 131.7 |
| 4'' (CH3) | 25.8 |
| 5'' (CH3) | 17.9 |
| 5a (CH3) | 56 |
| 7a (CH3) | 60.9 |