Common Name: Linixanthone B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C19H16O5/c1-19(2)8-7-10-9-11-15(21)14-12(20)5-4-6-13(14)23-17(11)18(22-3)16(10)24-19/h4-9,20H,1-3H3
InChIKey: InChIKey=JRTRHKZHVTTZNZ-UHFFFAOYSA-N
Formula: C19H16O5
Molecular Weight: 324.328059
Exact Mass: 324.099774
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Li, X., Ohtsuki, T., Shindo, S., Sato, M., Koyano, T., Preeprame, S., Kowithayakorn, T., Ishibashi, M. Planta Med (2007) 73, 1195-6
Species:
Notes: Family : Aromatics, Type : Xanthones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 161.8 |
| 2 (CH) | 110.6 |
| 3 (CH) | 136.2 |
| 4 (CH) | 107.2 |
| 4a (C) | 156.3 |
| 5 (C) | 135.7 |
| 6 (C) | 151.6 |
| 7 (C) | 119.1 |
| 8 (CH) | 117.4 |
| 8a (C) | 117 |
| 9 (C) | 181.5 |
| 9a (C) | 108.7 |
| 10a (C) | 149.6 |
| 1' (CH) | 121.4 |
| 2' (CH) | 131.4 |
| 3' (C) | 79.2 |
| 4' (CH3) | 28.5 |
| 5' (CH3) | 28.5 |
| 5a (CH3) | 61.5 |