Common Name: Garcibenzopyran
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C18H20O3/c1-18(2)9-8-15-16(20-3)10-13(11-17(15)21-18)12-4-6-14(19)7-5-12/h4-7,10-11,19H,8-9H2,1-3H3
InChIKey: InChIKey=KVVMGMZBPAXQME-UHFFFAOYSA-N
Formula: C18H20O3
Molecular Weight: 284.350276
Exact Mass: 284.141245
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Li, X., Ohtsuki, T., Shindo, S., Sato, M., Koyano, T., Preeprame, S., Kowithayakorn, T., Ishibashi, M. Planta Med (2007) 73, 1195-6
Species:
Notes: Family : Aromatics, Type : Biphenyls; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 140 |
| 2 (CH) | 107.9 |
| 3 (C) | 116.2 |
| 4 (C) | 155.1 |
| 5 (C) | 158.2 |
| 6 (CH) | 101.6 |
| 1' (C) | 134.2 |
| 2' (CH) | 128.2 |
| 3' (CH) | 115.5 |
| 4' (C) | 155.3 |
| 5' (CH) | 115.5 |
| 6' (CH) | 128.2 |
| 1'' (CH2) | 17.1 |
| 2'' (CH2) | 41.9 |
| 3'' (C) | 72 |
| 4'' (CH3) | 29.7 |
| 5'' (CH3) | 29.7 |
| 3a (CH3) | 55.8 |